C24H30FNO3 — CID 100683972
N-(4-butoxy-3,5-dimethylphenyl)-4-(4-fluorophenyl)oxane-4-carboxamide (PubChem CID 100683972) has the molecular formula C24H30FNO3 and a molecular weight of 399.51 g/mol. Its IUPAC name is N-(4-butoxy-3,5-dimethylphenyl)-4-(4-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-(4-butoxy-3,5-dimethylphenyl)-4-(4-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 100683972 |
| Molecular Formula | C24H30FNO3 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-(4-butoxy-3,5-dimethylphenyl)-4-(4-fluorophenyl)oxane-4-carboxamide |
| SMILES | CCCCOc1c(C)cc(NC(=O)C2(c3ccc(F)cc3)CCOCC2)cc1C |
| InChI | InChI=1S/C24H30FNO3/c1-4-5-12-29-22-17(2)15-21(16-18(22)3)26-23(27)24(10-13-28-14-11-24)19-6-8-20(25)9-7-19/h6-9,15-16H,4-5,10-14H2,1-3H3,(H,26,27) |
| InChIKey | UTSNNYDOFHGNKO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|