C25H33NO2 — CID 100669904
N-(4-butoxy-3,5-dimethylphenyl)-1-phenylcyclohexane-1-carboxamide (PubChem CID 100669904) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is N-(4-butoxy-3,5-dimethylphenyl)-1-phenylcyclohexane-1-carboxamide.
| Compound Name | N-(4-butoxy-3,5-dimethylphenyl)-1-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100669904 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | N-(4-butoxy-3,5-dimethylphenyl)-1-phenylcyclohexane-1-carboxamide |
| SMILES | CCCCOc1c(C)cc(NC(=O)C2(c3ccccc3)CCCCC2)cc1C |
| InChI | InChI=1S/C25H33NO2/c1-4-5-16-28-23-19(2)17-22(18-20(23)3)26-24(27)25(14-10-7-11-15-25)21-12-8-6-9-13-21/h6,8-9,12-13,17-18H,4-5,7,10-11,14-16H2,1-3H3,(H,26,27) |
| InChIKey | GZFADLJCSIEMNZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|