C28H31NO2 — CID 100669967
N-(3,5-dimethyl-4-phenylmethoxyphenyl)-1-phenylcyclohexane-1-carboxamide (PubChem CID 100669967) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-(3,5-dimethyl-4-phenylmethoxyphenyl)-1-phenylcyclohexane-1-carboxamide.
| Compound Name | N-(3,5-dimethyl-4-phenylmethoxyphenyl)-1-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100669967 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-(3,5-dimethyl-4-phenylmethoxyphenyl)-1-phenylcyclohexane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2(c3ccccc3)CCCCC2)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C28H31NO2/c1-21-18-25(19-22(2)26(21)31-20-23-12-6-3-7-13-23)29-27(30)28(16-10-5-11-17-28)24-14-8-4-9-15-24/h3-4,6-9,12-15,18-19H,5,10-11,16-17,20H2,1-2H3,(H,29,30) |
| InChIKey | QQDGNRQPIPSYNU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |