C19H17FN2O4 — CID 51125644
4-(3-fluorophenyl)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)oxane-4-carboxamide (PubChem CID 51125644) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)oxane-4-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 51125644 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 4-(3-fluorophenyl)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)oxane-4-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)[nH]c2c1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C19H17FN2O4/c20-13-3-1-2-12(10-13)19(6-8-25-9-7-19)17(23)21-14-4-5-16-15(11-14)22-18(24)26-16/h1-5,10-11H,6-9H2,(H,21,23)(H,22,24) |
| InChIKey | XBKKWMLKHQCFPM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |