C17H15FN2O4 — CID 51089599
4-(3-fluorophenoxy)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)butanamide (PubChem CID 51089599) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)butanamide.
| Compound Name | 4-(3-fluorophenoxy)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 51089599 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-(3-fluorophenoxy)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)butanamide |
| SMILES | O=C(CCCOc1cccc(F)c1)Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H15FN2O4/c18-11-3-1-4-13(9-11)23-8-2-5-16(21)19-12-6-7-15-14(10-12)20-17(22)24-15/h1,3-4,6-7,9-10H,2,5,8H2,(H,19,21)(H,20,22) |
| InChIKey | NIHYRUYPZOTMHQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|