C22H27NO — CID 1220424
1-phenyl-N-[(2S)-4-phenylbutan-2-yl]cyclopentane-1-carboxamide (PubChem CID 1220424) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-phenyl-N-[(2S)-4-phenylbutan-2-yl]cyclopentane-1-carboxamide.
| Compound Name | 1-phenyl-N-[(2S)-4-phenylbutan-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 1220424 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-phenyl-N-[(2S)-4-phenylbutan-2-yl]cyclopentane-1-carboxamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C22H27NO/c1-18(14-15-19-10-4-2-5-11-19)23-21(24)22(16-8-9-17-22)20-12-6-3-7-13-20/h2-7,10-13,18H,8-9,14-17H2,1H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | ATJNZKZWGUGVLH-SFHVURJKSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |