C24H30N2O2 — CID 7270600
N'-[(2S)-4-phenylbutan-2-yl]-N-[(1-phenylcyclopentyl)methyl]oxamide (PubChem CID 7270600) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N'-[(2S)-4-phenylbutan-2-yl]-N-[(1-phenylcyclopentyl)methyl]oxamide.
| Compound Name | N'-[(2S)-4-phenylbutan-2-yl]-N-[(1-phenylcyclopentyl)methyl]oxamide |
|---|---|
| PubChem CID | 7270600 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N'-[(2S)-4-phenylbutan-2-yl]-N-[(1-phenylcyclopentyl)methyl]oxamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)C(=O)NCC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C24H30N2O2/c1-19(14-15-20-10-4-2-5-11-20)26-23(28)22(27)25-18-24(16-8-9-17-24)21-12-6-3-7-13-21/h2-7,10-13,19H,8-9,14-18H2,1H3,(H,25,27)(H,26,28)/t19-/m0/s1 |
| InChIKey | CXAJIHSZOKTVAJ-IBGZPJMESA-N |
| XLogP | 3.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|