C21H26N2O — CID 113214970
1-[(1-phenylcyclobutyl)methyl]-3-(2-propan-2-ylphenyl)urea (PubChem CID 113214970) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[(1-phenylcyclobutyl)methyl]-3-(2-propan-2-ylphenyl)urea.
| Compound Name | 1-[(1-phenylcyclobutyl)methyl]-3-(2-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 113214970 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[(1-phenylcyclobutyl)methyl]-3-(2-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccccc1NC(=O)NCC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C21H26N2O/c1-16(2)18-11-6-7-12-19(18)23-20(24)22-15-21(13-8-14-21)17-9-4-3-5-10-17/h3-7,9-12,16H,8,13-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | VDHPZZPTEQFAQF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |