C24H32N2O — CID 14977526
1-[2,6-di(propan-2-yl)phenyl]-3-[(1-phenylcyclobutyl)methyl]urea (PubChem CID 14977526) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-phenylcyclobutyl)methyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-phenylcyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 14977526 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-phenylcyclobutyl)methyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C24H32N2O/c1-17(2)20-12-8-13-21(18(3)4)22(20)26-23(27)25-16-24(14-9-15-24)19-10-6-5-7-11-19/h5-8,10-13,17-18H,9,14-16H2,1-4H3,(H2,25,26,27) |
| InChIKey | LFMKUPRSZLNROF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |