C30H44N2O — CID 67942789
N-[2,6-di(propan-2-yl)phenyl]-2-[(1-phenylcyclopentyl)methylamino]hexanamide (PubChem CID 67942789) has the molecular formula C30H44N2O and a molecular weight of 448.70 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[(1-phenylcyclopentyl)methylamino]hexanamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(1-phenylcyclopentyl)methylamino]hexanamide |
|---|---|
| PubChem CID | 67942789 |
| Molecular Formula | C30H44N2O |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(1-phenylcyclopentyl)methylamino]hexanamide |
| SMILES | CCCCC(NCC1(c2ccccc2)CCCC1)C(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C30H44N2O/c1-6-7-18-27(31-21-30(19-11-12-20-30)24-14-9-8-10-15-24)29(33)32-28-25(22(2)3)16-13-17-26(28)23(4)5/h8-10,13-17,22-23,27,31H,6-7,11-12,18-21H2,1-5H3,(H,32,33) |
| InChIKey | KPKLQVYMMZKFHV-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |