C21H34N2O3 — CID 3779877
ethyl 2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]hexanoate (PubChem CID 3779877) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is ethyl 2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]hexanoate.
| Compound Name | ethyl 2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 3779877 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | ethyl 2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]hexanoate |
| SMILES | CCCCC(NC(=O)Nc1c(C(C)C)cccc1C(C)C)C(=O)OCC |
| InChI | InChI=1S/C21H34N2O3/c1-7-9-13-18(20(24)26-8-2)22-21(25)23-19-16(14(3)4)11-10-12-17(19)15(5)6/h10-12,14-15,18H,7-9,13H2,1-6H3,(H2,22,23,25) |
| InChIKey | HQHJVMWATJCVAV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |