C24H33N3O — CID 14977528
1-[2,6-di(propan-2-yl)phenyl]-3-[(1-pyridin-3-ylcyclopentyl)methyl]urea (PubChem CID 14977528) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-pyridin-3-ylcyclopentyl)methyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-pyridin-3-ylcyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 14977528 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-pyridin-3-ylcyclopentyl)methyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCC1(c2cccnc2)CCCC1 |
| InChI | InChI=1S/C24H33N3O/c1-17(2)20-10-7-11-21(18(3)4)22(20)27-23(28)26-16-24(12-5-6-13-24)19-9-8-14-25-15-19/h7-11,14-15,17-18H,5-6,12-13,16H2,1-4H3,(H2,26,27,28) |
| InChIKey | PAOCTPCYNFKYCQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |