C11H16N2 — CID 80522291
N-methyl-1-(1-pyridin-3-ylcyclobutyl)methanamine (PubChem CID 80522291) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-methyl-1-(1-pyridin-3-ylcyclobutyl)methanamine.
| Compound Name | N-methyl-1-(1-pyridin-3-ylcyclobutyl)methanamine |
|---|---|
| PubChem CID | 80522291 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-methyl-1-(1-pyridin-3-ylcyclobutyl)methanamine |
| SMILES | CNCC1(c2cccnc2)CCC1 |
| InChI | InChI=1S/C11H16N2/c1-12-9-11(5-3-6-11)10-4-2-7-13-8-10/h2,4,7-8,12H,3,5-6,9H2,1H3 |
| InChIKey | BCZHLNUKOXKSBJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |