C20H22F2N2O2 — CID 56586698
1-[2-(difluoromethoxy)-6-methylphenyl]-3-[(1-phenylcyclobutyl)methyl]urea (PubChem CID 56586698) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-6-methylphenyl]-3-[(1-phenylcyclobutyl)methyl]urea.
| Compound Name | 1-[2-(difluoromethoxy)-6-methylphenyl]-3-[(1-phenylcyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 56586698 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[2-(difluoromethoxy)-6-methylphenyl]-3-[(1-phenylcyclobutyl)methyl]urea |
| SMILES | Cc1cccc(OC(F)F)c1NC(=O)NCC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-14-7-5-10-16(26-18(21)22)17(14)24-19(25)23-13-20(11-6-12-20)15-8-3-2-4-9-15/h2-5,7-10,18H,6,11-13H2,1H3,(H2,23,24,25) |
| InChIKey | KPGVUYFBNCECKD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |