C23H27N3O3 — CID 86996810
N'-[4-[2-oxo-2-(propan-2-ylamino)ethyl]phenyl]-N-[(1-phenylcyclopropyl)methyl]oxamide (PubChem CID 86996810) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N'-[4-[2-oxo-2-(propan-2-ylamino)ethyl]phenyl]-N-[(1-phenylcyclopropyl)methyl]oxamide.
| Compound Name | N'-[4-[2-oxo-2-(propan-2-ylamino)ethyl]phenyl]-N-[(1-phenylcyclopropyl)methyl]oxamide |
|---|---|
| PubChem CID | 86996810 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N'-[4-[2-oxo-2-(propan-2-ylamino)ethyl]phenyl]-N-[(1-phenylcyclopropyl)methyl]oxamide |
| SMILES | CC(C)NC(=O)Cc1ccc(NC(=O)C(=O)NCC2(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-16(2)25-20(27)14-17-8-10-19(11-9-17)26-22(29)21(28)24-15-23(12-13-23)18-6-4-3-5-7-18/h3-11,16H,12-15H2,1-2H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | AVBYVUHUZHNWNQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|