C20H19N5O2 — CID 86996807
N-[(1-phenylcyclopropyl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide (PubChem CID 86996807) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[(1-phenylcyclopropyl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide.
| Compound Name | N-[(1-phenylcyclopropyl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 86996807 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(1-phenylcyclopropyl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide |
| SMILES | O=C(NCC1(c2ccccc2)CC1)C(=O)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C20H19N5O2/c26-18(22-12-20(10-11-20)15-4-2-1-3-5-15)19(27)24-16-6-8-17(9-7-16)25-14-21-13-23-25/h1-9,13-14H,10-12H2,(H,22,26)(H,24,27) |
| InChIKey | OAPRKUBUZVKBAU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|