5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid

C13H14N4O3 — CID 60934318

IUPAC5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid
SMILESO=C(O)CCCC(=O)Nc1ccc(-n2cncn2)cc1
InChIInChI=1S/C13H14N4O3/c18-12(2-1-3-13(19)20)16-10-4-6-11(7-5-10)17-9-14-8-15-17/h4-9H,1-3H2,(H,16,18)(H,19,20)
InChIKeyDNGZQFGPOUKICD-UHFFFAOYSA-N
MW274.28 g/mol
LogP1.46
Rot. Bonds6

About 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid

5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid (PubChem CID 60934318) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid.

Molecular Properties

Compound Name5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid
PubChem CID60934318
Molecular FormulaC13H14N4O3
Molecular Weight274.28 g/mol
Exact Mass274.11
IUPAC Name5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid
SMILESO=C(O)CCCC(=O)Nc1ccc(-n2cncn2)cc1
InChIInChI=1S/C13H14N4O3/c18-12(2-1-3-13(19)20)16-10-4-6-11(7-5-10)17-9-14-8-15-17/h4-9H,1-3H2,(H,16,18)(H,19,20)
InChIKeyDNGZQFGPOUKICD-UHFFFAOYSA-N
XLogP1.46
TPSA97.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.28
LogP ≤ 51.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid?
The IUPAC name of 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid (CID 60934318) is 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid.
What is the SMILES notation for 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid?
The canonical SMILES for 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid is O=C(O)CCCC(=O)Nc1ccc(-n2cncn2)cc1.
What is the InChIKey of 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid?
The InChIKey is DNGZQFGPOUKICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O3/c18-12(2-1-3-13(19)20)16-10-4-6-11(7-5-10)17-9-14-8-15-17/h4-9H,1-3H2,(H,16,18)(H,19,20).
What are the key properties of 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid?
5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid has a molecular weight of 274.28 g/mol, XLogP of 1.46, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-5-[4-(1,2,4-triazol-1-yl)anilino]pentanoic acid is sourced from PubChem (CID 60934318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).