C16H21N5O2S — CID 11551982
6-[(2-sulfanylacetyl)amino]-N-[4-(1,2,4-triazol-1-yl)phenyl]hexanamide (PubChem CID 11551982) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 6-[(2-sulfanylacetyl)amino]-N-[4-(1,2,4-triazol-1-yl)phenyl]hexanamide.
| Compound Name | 6-[(2-sulfanylacetyl)amino]-N-[4-(1,2,4-triazol-1-yl)phenyl]hexanamide |
|---|---|
| PubChem CID | 11551982 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 6-[(2-sulfanylacetyl)amino]-N-[4-(1,2,4-triazol-1-yl)phenyl]hexanamide |
| SMILES | O=C(CS)NCCCCCC(=O)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H21N5O2S/c22-15(4-2-1-3-9-18-16(23)10-24)20-13-5-7-14(8-6-13)21-12-17-11-19-21/h5-8,11-12,24H,1-4,9-10H2,(H,18,23)(H,20,22) |
| InChIKey | VNLSRHWOPJOFBG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|