C12H10N4O3 — CID 54867041
(E)-4-oxo-4-[4-(1,2,4-triazol-1-yl)anilino]but-2-enoic acid (PubChem CID 54867041) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-(1,2,4-triazol-1-yl)anilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-(1,2,4-triazol-1-yl)anilino]but-2-enoic acid |
|---|---|
| PubChem CID | 54867041 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (E)-4-oxo-4-[4-(1,2,4-triazol-1-yl)anilino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C12H10N4O3/c17-11(5-6-12(18)19)15-9-1-3-10(4-2-9)16-8-13-7-14-16/h1-8H,(H,15,17)(H,18,19)/b6-5+ |
| InChIKey | OJGYOBGYVPJEJZ-AATRIKPKSA-N |
| XLogP | 0.85 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|