C16H11ClN6OS — CID 37121177
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide (PubChem CID 37121177) has the molecular formula C16H11ClN6OS and a molecular weight of 370.83 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 37121177 |
| Molecular Formula | C16H11ClN6OS |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H11ClN6OS/c17-15-13(22-7-8-25-16(22)21-15)5-6-14(24)20-11-1-3-12(4-2-11)23-10-18-9-19-23/h1-10H,(H,20,24)/b6-5+ |
| InChIKey | YWBFSYHRHZFRFT-AATRIKPKSA-N |
| XLogP | 3.28 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|