C15H10ClN3O3S — CID 2348698
(E)-N-(1,3-benzodioxol-5-yl)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide (PubChem CID 2348698) has the molecular formula C15H10ClN3O3S and a molecular weight of 347.78 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2348698 |
| Molecular Formula | C15H10ClN3O3S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H10ClN3O3S/c16-14-10(19-5-6-23-15(19)18-14)2-4-13(20)17-9-1-3-11-12(7-9)22-8-21-11/h1-7H,8H2,(H,17,20)/b4-2+ |
| InChIKey | GMGQPMUHFQYGIX-DUXPYHPUSA-N |
| XLogP | 3.43 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|