C10H8ClN3O3S — CID 43354436
2-[[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]amino]acetic acid (PubChem CID 43354436) has the molecular formula C10H8ClN3O3S and a molecular weight of 285.71 g/mol. Its IUPAC name is 2-[[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 43354436 |
| Molecular Formula | C10H8ClN3O3S |
| Molecular Weight | 285.71 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-[[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)/C=C/c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C10H8ClN3O3S/c11-9-6(14-3-4-18-10(14)13-9)1-2-7(15)12-5-8(16)17/h1-4H,5H2,(H,12,15)(H,16,17)/b2-1+ |
| InChIKey | SUKJPKWUEJGJAW-OWOJBTEDSA-N |
| XLogP | 1.26 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.71 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|