C17H16ClN3OS — CID 32979324
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 32979324) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 32979324 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)NCCCc1ccccc1 |
| InChI | InChI=1S/C17H16ClN3OS/c18-16-14(21-11-12-23-17(21)20-16)8-9-15(22)19-10-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-9,11-12H,4,7,10H2,(H,19,22)/b9-8+ |
| InChIKey | GVRPSLVCTKAWPK-CMDGGOBGSA-N |
| XLogP | 3.81 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|