C13H14ClN3OS — CID 115628070
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[(E)-pent-3-enyl]prop-2-enamide (PubChem CID 115628070) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[(E)-pent-3-enyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[(E)-pent-3-enyl]prop-2-enamide |
|---|---|
| PubChem CID | 115628070 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[(E)-pent-3-enyl]prop-2-enamide |
| SMILES | C/C=C/CCNC(=O)/C=C/c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C13H14ClN3OS/c1-2-3-4-7-15-11(18)6-5-10-12(14)16-13-17(10)8-9-19-13/h2-3,5-6,8-9H,4,7H2,1H3,(H,15,18)/b3-2+,6-5+ |
| InChIKey | GTISUKICFSGYGR-ZIMISOLQSA-N |
| XLogP | 3.14 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|