C13H16ClN3O3S — CID 103877078
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-hydroxy-4-methoxybutyl)prop-2-enamide (PubChem CID 103877078) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-hydroxy-4-methoxybutyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-hydroxy-4-methoxybutyl)prop-2-enamide |
|---|---|
| PubChem CID | 103877078 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-hydroxy-4-methoxybutyl)prop-2-enamide |
| SMILES | COCC(O)CCNC(=O)/C=C/c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C13H16ClN3O3S/c1-20-8-9(18)4-5-15-11(19)3-2-10-12(14)16-13-17(10)6-7-21-13/h2-3,6-7,9,18H,4-5,8H2,1H3,(H,15,19)/b3-2+ |
| InChIKey | BYNJSNNEYSKTKC-NSCUHMNNSA-N |
| XLogP | 1.58 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|