C11H10ClN3O4S — CID 77113688
3-[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]-2-hydroxypropanoic acid (PubChem CID 77113688) has the molecular formula C11H10ClN3O4S and a molecular weight of 315.74 g/mol. Its IUPAC name is 3-[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 77113688 |
| Molecular Formula | C11H10ClN3O4S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 3-[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]-2-hydroxypropanoic acid |
| SMILES | O=C(C=Cc1c(Cl)nc2sccn12)NCC(O)C(=O)O |
| InChI | InChI=1S/C11H10ClN3O4S/c12-9-6(15-3-4-20-11(15)14-9)1-2-8(17)13-5-7(16)10(18)19/h1-4,7,16H,5H2,(H,13,17)(H,18,19) |
| InChIKey | WQGVPBSSFZKMMG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|