C12H12ClN3O4S — CID 61244376
2-[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]-4-hydroxybutanoic acid (PubChem CID 61244376) has the molecular formula C12H12ClN3O4S and a molecular weight of 329.77 g/mol. Its IUPAC name is 2-[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61244376 |
| Molecular Formula | C12H12ClN3O4S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 2-[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(C=Cc1c(Cl)nc2sccn12)NC(CCO)C(=O)O |
| InChI | InChI=1S/C12H12ClN3O4S/c13-10-8(16-4-6-21-12(16)15-10)1-2-9(18)14-7(3-5-17)11(19)20/h1-2,4,6-7,17H,3,5H2,(H,14,18)(H,19,20) |
| InChIKey | YSCPNIJGJXRNHD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|