C13H10ClN3OS2 — CID 32983057
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 32983057) has the molecular formula C13H10ClN3OS2 and a molecular weight of 323.83 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 32983057 |
| Molecular Formula | C13H10ClN3OS2 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)NCc1cccs1 |
| InChI | InChI=1S/C13H10ClN3OS2/c14-12-10(17-5-7-20-13(17)16-12)3-4-11(18)15-8-9-2-1-6-19-9/h1-7H,8H2,(H,15,18)/b4-3+ |
| InChIKey | LBJMAGPLYQBFET-ONEGZZNKSA-N |
| XLogP | 3.44 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|