C16H14ClN3OS2 — CID 37484172
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-cyclopropyl-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 37484172) has the molecular formula C16H14ClN3OS2 and a molecular weight of 363.90 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-cyclopropyl-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-cyclopropyl-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 37484172 |
| Molecular Formula | C16H14ClN3OS2 |
| Molecular Weight | 363.90 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-cyclopropyl-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C16H14ClN3OS2/c17-15-13(19-7-9-23-16(19)18-15)5-6-14(21)20(11-3-4-11)10-12-2-1-8-22-12/h1-2,5-9,11H,3-4,10H2/b6-5+ |
| InChIKey | QTFAQSDTSXPQLJ-AATRIKPKSA-N |
| XLogP | 4.32 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.90 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|