C12H11ClN6OS — CID 77045816
3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide (PubChem CID 77045816) has the molecular formula C12H11ClN6OS and a molecular weight of 322.78 g/mol. Its IUPAC name is 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide.
| Compound Name | 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 77045816 |
| Molecular Formula | C12H11ClN6OS |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)C=Cc1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C12H11ClN6OS/c1-18(6-9-14-7-15-17-9)10(20)3-2-8-11(13)16-12-19(8)4-5-21-12/h2-5,7H,6H2,1H3,(H,14,15,17) |
| InChIKey | UCLTYTWPXASZIA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|