C16H16N2OS — CID 134004593
(E)-N-cyclopropyl-3-pyridin-3-yl-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 134004593) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-pyridin-3-yl-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-pyridin-3-yl-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 134004593 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (E)-N-cyclopropyl-3-pyridin-3-yl-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C16H16N2OS/c19-16(8-5-13-3-1-9-17-11-13)18(14-6-7-14)12-15-4-2-10-20-15/h1-5,8-11,14H,6-7,12H2/b8-5+ |
| InChIKey | OGFMMQYVHKPJJO-VMPITWQZSA-N |
| XLogP | 3.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|