C22H23N3OS — CID 37484166
(E)-N-cyclopropyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 37484166) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 37484166 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (E)-N-cyclopropyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C22H23N3OS/c1-16-21(17(2)25(23-16)19-7-4-3-5-8-19)12-13-22(26)24(18-10-11-18)15-20-9-6-14-27-20/h3-9,12-14,18H,10-11,15H2,1-2H3/b13-12+ |
| InChIKey | SVDZPWPOSNSPEF-OUKQBFOZSA-N |
| XLogP | 4.76 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|