C22H25N3O2S — CID 9168429
(E)-N-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 9168429) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is (E)-N-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9168429 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (E)-N-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | COc1ccccc1CN(Cc1cccs1)C(=O)/C=C/c1c(C)nn(C)c1C |
| InChI | InChI=1S/C22H25N3O2S/c1-16-20(17(2)24(3)23-16)11-12-22(26)25(15-19-9-7-13-28-19)14-18-8-5-6-10-21(18)27-4/h5-13H,14-15H2,1-4H3/b12-11+ |
| InChIKey | OBWCKOJSNAWHRY-VAWYXSNFSA-N |
| XLogP | 4.35 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|