C26H26N2O3S — CID 55498850
(E)-N-[(2-methoxyphenyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 55498850) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is (E)-N-[(2-methoxyphenyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-[(2-methoxyphenyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55498850 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (E)-N-[(2-methoxyphenyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | COc1ccccc1CN(Cc1cccs1)C(=O)/C=C/c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-31-24-8-3-2-6-21(24)18-27(19-23-7-5-17-32-23)25(29)15-12-20-10-13-22(14-11-20)28-16-4-9-26(28)30/h2-3,5-8,10-15,17H,4,9,16,18-19H2,1H3/b15-12+ |
| InChIKey | NCGGSRRDNSLYSU-NTCAYCPXSA-N |
| XLogP | 5.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|