C17H21NO4S2 — CID 134034593
N-[(2-methoxyphenyl)methyl]-3-methylsulfonyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 134034593) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-3-methylsulfonyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-3-methylsulfonyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 134034593 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-3-methylsulfonyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | COc1ccccc1CN(Cc1cccs1)C(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C17H21NO4S2/c1-22-16-8-4-3-6-14(16)12-18(13-15-7-5-10-23-15)17(19)9-11-24(2,20)21/h3-8,10H,9,11-13H2,1-2H3 |
| InChIKey | OYGDEZQAHFGFMA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |