C22H23N3O4S — CID 24627559
N-[(2-methoxyphenyl)methyl]-3-(2-nitroanilino)-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 24627559) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-3-(2-nitroanilino)-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-3-(2-nitroanilino)-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 24627559 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-3-(2-nitroanilino)-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | COc1ccccc1CN(Cc1cccs1)C(=O)CCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23N3O4S/c1-29-21-11-5-2-7-17(21)15-24(16-18-8-6-14-30-18)22(26)12-13-23-19-9-3-4-10-20(19)25(27)28/h2-11,14,23H,12-13,15-16H2,1H3 |
| InChIKey | HYGUCOAFPQSTQP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|