C21H21NO4S2 — CID 55333106
N-[(2-methoxyphenyl)methyl]-3-methylsulfonyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 55333106) has the molecular formula C21H21NO4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-3-methylsulfonyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-3-methylsulfonyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55333106 |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-3-methylsulfonyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1CN(Cc1cccs1)C(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H21NO4S2/c1-26-20-11-4-3-7-17(20)14-22(15-18-9-6-12-27-18)21(23)16-8-5-10-19(13-16)28(2,24)25/h3-13H,14-15H2,1-2H3 |
| InChIKey | YGVSKBZVVPNVCH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |