C23H29N3O — CID 9489460
(E)-1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 9489460) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is (E)-1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9489460 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (E)-1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)N1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C23H29N3O/c1-17-21(18(2)26(24-17)20-11-4-3-5-12-20)14-15-23(27)25-16-8-10-19-9-6-7-13-22(19)25/h3-5,11-12,14-15,19,22H,6-10,13,16H2,1-2H3/b15-14+/t19-,22+/m1/s1 |
| InChIKey | LHWGJUFJNRZZCG-LPMGRZKESA-N |
| XLogP | 4.68 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|