C26H28N4O2 — CID 39566963
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[4-(4-methylbenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 39566963) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[4-(4-methylbenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[4-(4-methylbenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 39566963 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[4-(4-methylbenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)/C=C/c3c(C)nn(-c4ccccc4)c3C)CC2)cc1 |
| InChI | InChI=1S/C26H28N4O2/c1-19-9-11-22(12-10-19)26(32)29-17-15-28(16-18-29)25(31)14-13-24-20(2)27-30(21(24)3)23-7-5-4-6-8-23/h4-14H,15-18H2,1-3H3/b14-13+ |
| InChIKey | SVXSSQADKJMWHK-BUHFOSPRSA-N |
| XLogP | 3.80 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|