C24H24ClFN4O — CID 26693311
(E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one (PubChem CID 26693311) has the molecular formula C24H24ClFN4O and a molecular weight of 438.93 g/mol. Its IUPAC name is (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26693311 |
| Molecular Formula | C24H24ClFN4O |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/C=C/C(=O)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H24ClFN4O/c1-17-21(18(2)30(27-17)20-9-7-19(26)8-10-20)11-12-24(31)29-15-13-28(14-16-29)23-6-4-3-5-22(23)25/h3-12H,13-16H2,1-2H3/b12-11+ |
| InChIKey | XOXSWGLROMNDAS-VAWYXSNFSA-N |
| XLogP | 4.64 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|