C22H26ClFN4O — CID 55591045
(E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(4-cyclopentylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 55591045) has the molecular formula C22H26ClFN4O and a molecular weight of 416.93 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(4-cyclopentylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(4-cyclopentylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55591045 |
| Molecular Formula | C22H26ClFN4O |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(4-cyclopentylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=C/C(=O)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C22H26ClFN4O/c1-16-20(22(23)28(25-16)19-8-6-17(24)7-9-19)10-11-21(29)27-14-12-26(13-15-27)18-4-2-3-5-18/h6-11,18H,2-5,12-15H2,1H3/b11-10+ |
| InChIKey | KWRXOTIKFDSLHK-ZHACJKMWSA-N |
| XLogP | 4.07 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|