C19H19ClFN3O — CID 56575870
(E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(4-methylidenepiperidin-1-yl)prop-2-en-1-one (PubChem CID 56575870) has the molecular formula C19H19ClFN3O and a molecular weight of 359.83 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(4-methylidenepiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(4-methylidenepiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 56575870 |
| Molecular Formula | C19H19ClFN3O |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-1-(4-methylidenepiperidin-1-yl)prop-2-en-1-one |
| SMILES | C=C1CCN(C(=O)/C=C/c2c(C)nn(-c3ccc(F)cc3)c2Cl)CC1 |
| InChI | InChI=1S/C19H19ClFN3O/c1-13-9-11-23(12-10-13)18(25)8-7-17-14(2)22-24(19(17)20)16-5-3-15(21)4-6-16/h3-8H,1,9-12H2,2H3/b8-7+ |
| InChIKey | CDTMHZRJIIIHJD-BQYQJAHWSA-N |
| XLogP | 4.17 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|