C23H22FN3O — CID 4883036
1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one (PubChem CID 4883036) has the molecular formula C23H22FN3O and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4883036 |
| Molecular Formula | C23H22FN3O |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C=CC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H22FN3O/c1-16-22(17(2)27(25-16)21-9-7-20(24)8-10-21)11-12-23(28)26-14-13-18-5-3-4-6-19(18)15-26/h3-12H,13-15H2,1-2H3 |
| InChIKey | SNLPVEHFDLHZRX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|