C19H22N4O2 — CID 97456193
(3S)-1-[(Z)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]pyrrolidine-3-carboxamide (PubChem CID 97456193) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (3S)-1-[(Z)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[(Z)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97456193 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (3S)-1-[(Z)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C\C(=O)N1CC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C19H22N4O2/c1-13-17(14(2)23(21-13)16-6-4-3-5-7-16)8-9-18(24)22-11-10-15(12-22)19(20)25/h3-9,15H,10-12H2,1-2H3,(H2,20,25)/b9-8-/t15-/m0/s1 |
| InChIKey | WMXNXVLNENTBOE-CDNLZTBQSA-N |
| XLogP | 1.84 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|