C14H15BrN2O2 — CID 97456076
(3R)-1-[(Z)-3-(2-bromophenyl)prop-2-enoyl]pyrrolidine-3-carboxamide (PubChem CID 97456076) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is (3R)-1-[(Z)-3-(2-bromophenyl)prop-2-enoyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[(Z)-3-(2-bromophenyl)prop-2-enoyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97456076 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | (3R)-1-[(Z)-3-(2-bromophenyl)prop-2-enoyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCN(C(=O)/C=C\c2ccccc2Br)C1 |
| InChI | InChI=1S/C14H15BrN2O2/c15-12-4-2-1-3-10(12)5-6-13(18)17-8-7-11(9-17)14(16)19/h1-6,11H,7-9H2,(H2,16,19)/b6-5-/t11-/m1/s1 |
| InChIKey | ZHUHKYFZVWUUME-ISALQUGTSA-N |
| XLogP | 1.80 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|