C15H16BrNO3 — CID 43239931
1-[(E)-3-(2-bromophenyl)prop-2-enoyl]piperidine-2-carboxylic acid (PubChem CID 43239931) has the molecular formula C15H16BrNO3 and a molecular weight of 338.20 g/mol. Its IUPAC name is 1-[(E)-3-(2-bromophenyl)prop-2-enoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(E)-3-(2-bromophenyl)prop-2-enoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43239931 |
| Molecular Formula | C15H16BrNO3 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 1-[(E)-3-(2-bromophenyl)prop-2-enoyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(=O)/C=C/c1ccccc1Br |
| InChI | InChI=1S/C15H16BrNO3/c16-12-6-2-1-5-11(12)8-9-14(18)17-10-4-3-7-13(17)15(19)20/h1-2,5-6,8-9,13H,3-4,7,10H2,(H,19,20)/b9-8+ |
| InChIKey | JYZWWNFYGDVIBL-CMDGGOBGSA-N |
| XLogP | 2.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|