C15H15Cl2NO3 — CID 79035391
(2R)-1-[3-(2,5-dichlorophenyl)prop-2-enoyl]piperidine-2-carboxylic acid (PubChem CID 79035391) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.19 g/mol. Its IUPAC name is (2R)-1-[3-(2,5-dichlorophenyl)prop-2-enoyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-(2,5-dichlorophenyl)prop-2-enoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79035391 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (2R)-1-[3-(2,5-dichlorophenyl)prop-2-enoyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCCN1C(=O)C=Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H15Cl2NO3/c16-11-5-6-12(17)10(9-11)4-7-14(19)18-8-2-1-3-13(18)15(20)21/h4-7,9,13H,1-3,8H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | CTTLGZAGONNNAF-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|