C15H17Cl2NO2 — CID 102784679
(E)-3-(2,5-dichlorophenyl)-1-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 102784679) has the molecular formula C15H17Cl2NO2 and a molecular weight of 314.21 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-1-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-dichlorophenyl)-1-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 102784679 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-1-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | CC1CCN(C(=O)/C=C/c2cc(Cl)ccc2Cl)C1CO |
| InChI | InChI=1S/C15H17Cl2NO2/c1-10-6-7-18(14(10)9-19)15(20)5-2-11-8-12(16)3-4-13(11)17/h2-5,8,10,14,19H,6-7,9H2,1H3/b5-2+ |
| InChIKey | HPQRYAMYTLQRQA-GORDUTHDSA-N |
| XLogP | 3.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|