C13H14Cl2INO2 — CID 102784634
(3,5-dichloro-2-iodophenyl)-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone (PubChem CID 102784634) has the molecular formula C13H14Cl2INO2 and a molecular weight of 414.07 g/mol. Its IUPAC name is (3,5-dichloro-2-iodophenyl)-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone.
| Compound Name | (3,5-dichloro-2-iodophenyl)-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 102784634 |
| Molecular Formula | C13H14Cl2INO2 |
| Molecular Weight | 414.07 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | (3,5-dichloro-2-iodophenyl)-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone |
| SMILES | CC1CCN(C(=O)c2cc(Cl)cc(Cl)c2I)C1CO |
| InChI | InChI=1S/C13H14Cl2INO2/c1-7-2-3-17(11(7)6-18)13(19)9-4-8(14)5-10(15)12(9)16/h4-5,7,11,18H,2-3,6H2,1H3 |
| InChIKey | YUEKVLCLKMQFNC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.07 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|