C12H11Cl2IN2O2 — CID 63606222
4-(3,5-dichloro-2-iodobenzoyl)-3-methylpiperazin-2-one (PubChem CID 63606222) has the molecular formula C12H11Cl2IN2O2 and a molecular weight of 413.04 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-iodobenzoyl)-3-methylpiperazin-2-one.
| Compound Name | 4-(3,5-dichloro-2-iodobenzoyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 63606222 |
| Molecular Formula | C12H11Cl2IN2O2 |
| Molecular Weight | 413.04 g/mol |
| Exact Mass | 411.92 |
| IUPAC Name | 4-(3,5-dichloro-2-iodobenzoyl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1C(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C12H11Cl2IN2O2/c1-6-11(18)16-2-3-17(6)12(19)8-4-7(13)5-9(14)10(8)15/h4-6H,2-3H2,1H3,(H,16,18) |
| InChIKey | QSLDQUKJYBWUQW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.04 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|